Systematic / IUPAC Name: N'-{[(4-Methyl-2-phenyl-1,3-thiazol-5-yl)carbonyl]oxy}-5-nitro-2-furancarboximidamide
ID: Reference8460
Other Names: 2-Furancarboximidamide, N'-[[(4-methyl-2-phenyl-5-thiazolyl)carbonyl]oxy]-5-nitro-
Formula: C16H12N4O5S
O2-[(4-Methyl-2-phenyl-1,3-thiazol-5-yl)carbonyl]-5-nitrofuran-2-carbohydroximamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 219 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/12/2018 12:03:58 PM |
| InChI | InChI=1S/C16H12N4O5S/c1-9-13(26-15(18-9)10-5-3-2-4-6-10)16(21)25-19-14(17)11-7-8-12(24-11)20(22)23/h2-8H,1H3,(H2,17,19) |
| InChI Key | OVTXLOWLWZSRDO-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(SC(=N1)C2=CC=CC=C2)C(=O)ON=C(C3=CC=C(O3)[N+](=O)[O-])N |
| CAS | |
| Splash | |
| Other Names | 2-Furancarboximidamide, N'-[[(4-methyl-2-phenyl-5-thiazolyl)carbonyl]oxy]-5-nitro- |