Systematic / IUPAC Name: 3,5-Diiodotyrosine
ID: Reference847
Other Names:
(S)-2-Amino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid;
3,5-Diiodo-4-hydroxy-β-phenylalanine;
3,5-L-Diiodotyrosine
Formula: C9H9I2NO3
Class: Endogenous Metabolites
3,5-Diiodo-L-tyrosine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 2 |
| No. of Spectra | 623 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/17/2015 9:49:52 AM |
| InChI | InChI=1S/C9H9I2NO3/c10-5-1-4(2-6(11)8(5)13)3-7(12)9(14)15/h1-2,7,13H,3,12H2,(H,14,15)/t7-/m0/s1 |
| InChI Key | NYPYHUZRZVSYKL-ZETCQYMHSA-N |
| Canonical SMILES | C1=C(C=C(C(=C1I)O)I)CC(C(=O)O)N |
| CAS | 300390 |
| Splash | |
| Other Names |
(S)-2-Amino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid; 3,5-Diiodo-4-hydroxy-β-phenylalanine; 3,5-L-Diiodotyrosine |
| KEGG | C01060 |
| Wikipedia | Diiodotyrosine |
| HMDb | HMDB03474 |
| PubChem | 9305; 7058163 |
| ChemIDPlus | 000300390 |
| ChemSpider | 8946 |
| ChEMBL | CHEMBL1236469 |
| ChEBI | CHEBI:15768 |