Systematic / IUPAC Name: N,N'-Bis(isopropyl)-6-(methylsulfanyl)-1,3,5-triazine-2,4-diamine
ID: Reference85
Other Names:
s-Triazine, 2,4-bis(isopropylamino)-6-(methylthio)-;
2,4-Bis(isopropylamino)-6-methylmercapto-s-triazine;
2,4-Bis(isopropylamino)-6-methylthio-1,3,5-triazine;
2,4-Bis(isopropylamino)-6-methylthio-s-triazine;
2-Methylthio-4,6-bis(isopropylamino)-s-triazine
; more
Formula: C10H19N5S
Class: Pesticides/Herbicides
Prometryn mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL; Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 663 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 11/3/2014 1:18:24 PM |
| InChI | InChI=1S/C10H19N5S/c1-6(2)11-8-13-9(12-7(3)4)15-10(14-8)16-5/h6-7H,1-5H3,(H2,11,12,13,14,15) |
| InChI Key | AAEVYOVXGOFMJO-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)NC1=NC(=NC(=N1)SC)NC(C)C |
| CAS | 7287196 |
| Splash | |
| Other Names |
s-Triazine, 2,4-bis(isopropylamino)-6-(methylthio)-; 2,4-Bis(isopropylamino)-6-methylmercapto-s-triazine; 2,4-Bis(isopropylamino)-6-methylthio-1,3,5-triazine; 2,4-Bis(isopropylamino)-6-methylthio-s-triazine; 2-Methylthio-4,6-bis(isopropylamino)-s-triazine; 4,6-Bis(isopropylamino)-2-(methylthio)-1,3,5-triazine; N2,N4-Diisopropyl-6-(methylthio)-1,3,5-triazine-2,4-diamine; Bis(isopropylamino)-6-(methylthio)-s-triazine; Prometryne; Gesagard; Prometrex; Caparol; Uvon; Primatol Q; Mercasin; Mercazin; Merkazin; Polisin; Prometrin; Selektin; Sesagard; Gesagard 50; Gesagarde 50 Wp; Selectin 50; Caparol 80W; Promethryn; Prometrene; Promepin; Prometryn solution; Cotton-Pro; Caparol 4L |
| ChEBI | CHEBI:26276 |
| ChemIDPlus | 007287196; 052081024; 008065223 |
| ChEMBL | CHEMBL1880257 |
| PubChem | 4929 |
| ChemSpider | 4760 |
| Wikipedia | Prometryn |
| KEGG | C18542 |