Systematic / IUPAC Name: N-(4-Fluorophenyl)-N-[1-(2-phenylethyl)-4-piperidinyl]tetrahydro-2-furancarboxamide
ID: Reference8509
Other Names:
2-Furancarboxamide, N-(4-fluorophenyl)tetrahydro-N-[1-(2-phenylethyl)-4-piperidinyl]-;
p-Fluoro tetrahydrofuran fentanyl
Formula: C24H29FN2O2
Class: Drugs of Abuse/Illegal Drugs
4-Fluoro tetrahydrofuran fentanyl mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 110 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/26/2019 1:13:25 PM |
| InChI | InChI=1S/C24H29FN2O2/c25-20-8-10-21(11-9-20)27(24(28)23-7-4-18-29-23)22-13-16-26(17-14-22)15-12-19-5-2-1-3-6-19/h1-3,5-6,8-11,22-23H,4,7,12-18H2 |
| InChI Key | DNWBTPZLCFRPRR-UHFFFAOYSA-N |
| Canonical SMILES | O=C(C1CCCO1)N(C1CCN(CCc2ccccc2)CC1)c1ccc(F)cc1 |
| CAS | |
| Splash | |
| Other Names |
2-Furancarboxamide, N-(4-fluorophenyl)tetrahydro-N-[1-(2-phenylethyl)-4-piperidinyl]-; p-Fluoro tetrahydrofuran fentanyl |