Systematic / IUPAC Name: N-(1-Benzylpiperidin-4-yl)-N-phenylprop-2-enamide
ID: Reference8519
Other Names: N-Phenyl-N-[1-(phenylmethyl)-4-piperidinyl]-2-propenamide
Formula: C21H24N2O
Class: Drugs of Abuse/Illegal Drugs
Benzyl acrylfentanyl mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 110 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/26/2019 11:13:02 AM |
| InChI | InChI=1S/C21H24N2O/c1-2-21(24)23(19-11-7-4-8-12-19)20-13-15-22(16-14-20)17-18-9-5-3-6-10-18/h2-12,20H,1,13-17H2 |
| InChI Key | BANFGBDVLADRGR-UHFFFAOYSA-N |
| Canonical SMILES | C=CC(=O)N(C1CCN(CC1)CC2=CC=CC=C2)C3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names | N-Phenyl-N-[1-(phenylmethyl)-4-piperidinyl]-2-propenamide |