Systematic / IUPAC Name: N,N-Diethyl-9,10-didehydroergoline-8-carboxamide
ID: Reference852
Other Names:
6-Norlysergic acid diethylamide;
N-Demethyllysergic acid diethylamide;
Ergoline-8-carboxamide, 9,10-didehydro-N,N-diethyl, (8β)-;
N-Demthyl-LSD
Formula: C19H23N3O
Class: Drugs of Abuse/Illegal Drugs
Nor-LSD mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 118 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/19/2015 1:53:58 PM |
| InChI | InChI=1S/C19H23N3O/c1-3-22(4-2)19(23)13-8-15-14-6-5-7-16-18(14)12(10-20-16)9-17(15)21-11-13/h5-8,10,13,17,20-21H,3-4,9,11H2,1-2H3/t13-,17-/m1/s1 |
| InChI Key | SUXLVXOMPKZBOV-CXAGYDPISA-N |
| Canonical SMILES | |
| CAS | 35779432 |
| Splash | |
| Other Names |
6-Norlysergic acid diethylamide; N-Demethyllysergic acid diethylamide; Ergoline-8-carboxamide, 9,10-didehydro-N,N-diethyl, (8β)-; N-Demthyl-LSD |
| ChemSpider | 530490 |
| ChEMBL | CHEMBL21343 |
| PubChem | 169713 |
| ChemIDPlus | 035779432 |