Systematic / IUPAC Name: 3-[(4-Fluorophenyl)methyl]-2-pyridin-3-yl-1,3-thiazolidin-4-one
ID: Reference8546
Other Names: 4-Thiazolidinone, 3-[(4-fluorophenyl)methyl]-2-(3-pyridinyl)-
Formula: C15H13FN2OS
3-(4-Fluorobenzyl)-2-(3-pyridyl)-1,3-thiazolan-4-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 110 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/27/2019 12:01:53 PM |
| InChI | InChI=1S/C15H13FN2OS/c16-13-5-3-11(4-6-13)9-18-14(19)10-20-15(18)12-2-1-7-17-8-12/h1-8,15H,9-10H2 |
| InChI Key | CYXIJQSXLATVAI-UHFFFAOYSA-N |
| Canonical SMILES | C1C(=O)N(C(S1)C2=CN=CC=C2)CC3=CC=C(C=C3)F |
| CAS | |
| Splash | |
| Other Names | 4-Thiazolidinone, 3-[(4-fluorophenyl)methyl]-2-(3-pyridinyl)- |