Systematic / IUPAC Name: 5-(2,6-Dichlorobenzyl)-6-methyl-2-(2-pyridinyl)-4(1H)-pyrimidinone
ID: Reference8557
Other Names:
4(1H)-Pyrimidinone, 5-[(2,6-dichlorophenyl)methyl]-6-methyl-2-(2-pyridinyl)-;
5-[(2,6-Dichlorophenyl)methyl]-6-methyl-2-pyridin-2-yl-1H-pyrimidin-4-one
Formula: C17H13Cl2N3O
5-(2,6-Dichlorobenzyl)-6-methyl-2-(2-pyridyl)pyrimidin-4-ol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 110 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/27/2019 12:53:39 PM |
| InChI | InChI=1S/C17H13Cl2N3O/c1-10-11(9-12-13(18)5-4-6-14(12)19)17(23)22-16(21-10)15-7-2-3-8-20-15/h2-8H,9H2,1H3,(H,21,22,23) |
| InChI Key | OBGQAOHMIOPUEX-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C(=O)NC(=N1)C2=CC=CC=N2)CC3=C(C=CC=C3Cl)Cl |
| CAS | |
| Splash | |
| Other Names |
4(1H)-Pyrimidinone, 5-[(2,6-dichlorophenyl)methyl]-6-methyl-2-(2-pyridinyl)-; 5-[(2,6-Dichlorophenyl)methyl]-6-methyl-2-pyridin-2-yl-1H-pyrimidin-4-one |
| PubChem | 2729978 |
| ChemSpider | 2011915 |
| ChEMBL | CHEMBL2398438 |