Systematic / IUPAC Name: 4-(4-Methoxyphenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarbonitrile
ID: Reference8558
Other Names: 3,5-Pyridinedicarbonitrile, 1,4-dihydro-4-(4-methoxyphenyl)-2,6-dimethyl-
Formula: C16H15N3O
4-(4-Methoxyphenyl)-2,6-dimethyl-1,4-dihydro-3,5-pyridinedicarbonitrile mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 220 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/27/2019 12:54:54 PM |
| InChI | InChI=1S/C16H15N3O/c1-10-14(8-17)16(15(9-18)11(2)19-10)12-4-6-13(20-3)7-5-12/h4-7,16,19H,1-3H3 |
| InChI Key | MHNNQUJGKFPEFW-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C(C(=C(N1)C)C#N)C2=CC=C(C=C2)OC)C#N |
| CAS | |
| Splash | |
| Other Names | 3,5-Pyridinedicarbonitrile, 1,4-dihydro-4-(4-methoxyphenyl)-2,6-dimethyl- |