Systematic / IUPAC Name: Methyl 2-[4-[(3,4-dichlorobenzoyl)amino]phenyl]-3,3,3-trifluoro-2-hydroxypropanoate
ID: Reference8563
Other Names:
Benzeneacetic acid, 4-[(3,4-dichlorobenzoyl)amino]-α-hydroxy-α-(trifluoromethyl)-, methyl ester;
Methyl 2-(4-{[(3,4-dichlorophenyl)carbonyl]amino}phenyl)-3,3,3-trifluoro-2-hydroxypropanoate
Formula: C17H12Cl2F3NO4
Methyl 2-{4-[(3,4-dichlorobenzoyl)amino]phenyl}-3,3,3-trifluoro-2-hydroxypropanoate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 109 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/4/2019 11:45:21 AM |
| InChI | InChI=1S/C17H12Cl2F3NO4/c1-27-15(25)16(26,17(20,21)22)10-3-5-11(6-4-10)23-14(24)9-2-7-12(18)13(19)8-9/h2-8,26H,1H3,(H,23,24) |
| InChI Key | SFBJWVSTISVAQL-UHFFFAOYSA-N |
| Canonical SMILES | COC(=O)C(C1=CC=C(C=C1)NC(=O)C2=CC(=C(C=C2)Cl)Cl)(C(F)(F)F)O |
| CAS | |
| Splash | |
| Other Names |
Benzeneacetic acid, 4-[(3,4-dichlorobenzoyl)amino]-α-hydroxy-α-(trifluoromethyl)-, methyl ester; Methyl 2-(4-{[(3,4-dichlorophenyl)carbonyl]amino}phenyl)-3,3,3-trifluoro-2-hydroxypropanoate |