Systematic / IUPAC Name: 3-Hydroxy-1-phenyl-4-(C-phenyl-N-propylcarbonimidoyl)pyrrole-2,5-dione
ID: Reference8565
Other Names: (4E)-1-Phenyl-4-[phenyl(propylamino)methylidene]pyrrolidine-2,3,5-trione
Formula: C20H18N2O3
1-Phenyl-4-[phenyl(propylamino)methylidene]pyrrolidine-2,3,5-trione mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 139 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/4/2019 11:49:54 AM |
| InChI | InChI=1S/C20H18N2O3/c1-2-13-21-17(14-9-5-3-6-10-14)16-18(23)20(25)22(19(16)24)15-11-7-4-8-12-15/h3-12,23H,2,13H2,1H3 |
| InChI Key | HSHMKDRVFBHMEE-UHFFFAOYSA-N |
| Canonical SMILES | CCCN=C(C1=CC=CC=C1)C2=C(C(=O)N(C2=O)C3=CC=CC=C3)O |
| CAS | |
| Splash | |
| Other Names | (4E)-1-Phenyl-4-[phenyl(propylamino)methylidene]pyrrolidine-2,3,5-trione |
| PubChem | 135473066 |