Systematic / IUPAC Name: 2-(Cyclohexylideneamino)guanidine
ID: Reference8566
Other Names:
2-Cyclohexylidenehydrazinecarboximidamide;
Carbonohydrazonic diamide, N''-cyclohexylidene-;
N''-Cyclohexylidenecarbonohydrazonic diamide
Formula: C7H14N4
N'-Cyclohexylidenaminomethanehydrazonamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 113 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/4/2019 11:52:53 AM |
| InChI | InChI=1S/C7H14N4/c8-7(9)11-10-6-4-2-1-3-5-6/h1-5H2,(H4,8,9,11) |
| InChI Key | YTTZYOIOUMXKKG-UHFFFAOYSA-N |
| Canonical SMILES | C1CCC(=NN=C(N)N)CC1 |
| CAS | |
| Splash | |
| Other Names |
2-Cyclohexylidenehydrazinecarboximidamide; Carbonohydrazonic diamide, N''-cyclohexylidene-; N''-Cyclohexylidenecarbonohydrazonic diamide |