Systematic / IUPAC Name: 2-[(1Z)-1-(4-Morpholinyl)-4,4-diphenyl-1,3-butadien-1-yl]phenyl acetate
ID: Reference8576
Other Names: Phenol, 2-[(1Z)-1-(4-morpholinyl)-4,4-diphenyl-1,3-butadien-1-yl]-, acetate (ester)
Formula: C28H27NO3
2-(1-Morpholino-4,4-diphenylbuta-1,3-dienyl)phenyl acetate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 110 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/4/2019 12:48:13 PM |
| InChI | InChI=1S/C28H27NO3/c1-22(30)32-28-15-9-8-14-26(28)27(29-18-20-31-21-19-29)17-16-25(23-10-4-2-5-11-23)24-12-6-3-7-13-24/h2-17H,18-21H2,1H3/b27-17- |
| InChI Key | JYWONHWIYFHFGV-PKAZHMFMSA-N |
| Canonical SMILES | CC(=O)OC1=CC=CC=C1C(=CC=C(C2=CC=CC=C2)C3=CC=CC=C3)N4CCOCC4 |
| CAS | |
| Splash | |
| Other Names | Phenol, 2-[(1Z)-1-(4-morpholinyl)-4,4-diphenyl-1,3-butadien-1-yl]-, acetate (ester) |