Systematic / IUPAC Name: 1-[4-(4-Chlorophenyl)-3-methyl-1,3-thiazol-2-ylidene]-3-(2-phenylethyl)thiourea
ID: Reference8580
Other Names:
Formula: C19H18ClN3S2
N-[4-(4-Chlorophenyl)-3-methyl-2,3-dihydro-1,3-thiazol-2-yliden]-N'-phenethylthiourea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 110 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/4/2019 1:47:57 PM |
| InChI | InChI=1S/C19H18ClN3S2/c1-23-17(15-7-9-16(20)10-8-15)13-25-19(23)22-18(24)21-12-11-14-5-3-2-4-6-14/h2-10,13H,11-12H2,1H3,(H,21,24) |
| InChI Key | KOTXPSQYMWIUCC-UHFFFAOYSA-N |
| Canonical SMILES | CN1C(=CSC1=NC(=S)NCCC2=CC=CC=C2)C3=CC=C(C=C3)Cl |
| CAS | |
| Splash | |
| Other Names |
| PubChem | 2725462 |