Systematic / IUPAC Name: 2-Chloro-N-phenyl-N-(propan-2-yl)acetamide
ID: Reference86
Other Names:
2-Chloro-N-isopropylacetanilide;
2-Chloro-N-isopropyl-N-phenylacetamide;
N-Isopropyl-α-chloroacetanilide;
Acetanilide, 2-chloro-N-isopropyl-;
Acetamide, 2-chloro-N-(1-methylethyl)-N-phenyl-
; more
Formula: C11H14ClNO
Class: Pesticides/Herbicides
Propachlor mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL; Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 600 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 2/27/2015 1:01:42 PM |
| InChI | InChI=1S/C11H14ClNO/c1-9(2)13(11(14)8-12)10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3 |
| InChI Key | MFOUDYKPLGXPGO-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)N(C1=CC=CC=C1)C(=O)CCl |
| CAS | 1918167 |
| Splash | |
| Other Names |
2-Chloro-N-isopropylacetanilide; 2-Chloro-N-isopropyl-N-phenylacetamide; N-Isopropyl-α-chloroacetanilide; Acetanilide, 2-chloro-N-isopropyl-; Acetamide, 2-chloro-N-(1-methylethyl)-N-phenyl-; N-Isopropyl-2-chloroacetanilide; α-Chloro-N-isopropylacetanilide; N-Methylethyl-N-chloroacidobenzene; 2-Chloro-N-(methylethyl)-N-phenylacetamide; Propachlor; Niticid; Bexton 4L; Propachlore; Nitacid; Satecid; Bexton; Prolex; Ramrod; Kartex A; Ramrod 65; Acilid; Ramrod flowable; Ramrod-atrazine; Ramrod 20G |
| KEGG | C18759 |
| ChEBI | CHEBI:19503 |
| ChemSpider | 4762 |
| PubChem | 4931 |
| ChemIDPlus | 001918167 |
| ChEMBL | CHEMBL1394829 |
| Wikipedia | Propachlor |