Systematic / IUPAC Name: 9-(2-O-Methylpentofuranosyl)-9H-purin-6-amine
ID: Reference860
Other Names:
Adenosine, 2'-O-methyl-;
(2R,3R,4R,5R)-5-(6-Amino-purin-9-yl)-2-hydroxymethyl-4-methoxy-tetrahydrofuran-3-ol;
5-(6-Aminopurin-9-yl)-2-(hydroxymethyl)-4-methoxyoxolan-3-ol;
Cordysinin B
Formula: C11H15N5O4
Class: Endogenous Metabolites
2'-O-Methyladenosine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 2 |
| No. of Spectra | 435 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/18/2015 4:01:12 PM |
| InChI | InChI=1S/C11H15N5O4/c1-19-8-7(18)5(2-17)20-11(8)16-4-15-6-9(12)13-3-14-10(6)16/h3-5,7-8,11,17-18H,2H2,1H3,(H2,12,13,14)/t5-,7-,8-,11-/m1/s1 |
| InChI Key | FPUGCISOLXNPPC-IOSLPCCCSA-N |
| Canonical SMILES | COC1C(C(OC1N2C=NC3=C2N=CN=C3N)CO)O |
| CAS | 2140796 |
| Splash | |
| Other Names |
Adenosine, 2'-O-methyl-; (2R,3R,4R,5R)-5-(6-Amino-purin-9-yl)-2-hydroxymethyl-4-methoxy-tetrahydrofuran-3-ol; 5-(6-Aminopurin-9-yl)-2-(hydroxymethyl)-4-methoxyoxolan-3-ol; Cordysinin B |
| ChEMBL | CHEMBL73237 |
| PubChem | 102213 |
| ChEBI | CHEBI:69426 |
| Wikipedia | 2'-O-Methyladenosin (DE) |
| ChemSpider | 280913 |
| ChemIDPlus | 002140796 |