Systematic / IUPAC Name: 2-Amino-3,5,6-trimethyl-4(3H)-pyrimidinone
ID: Reference8603
Other Names: 4(3H)-Pyrimidinone, 2-amino-3,5,6-trimethyl-
Formula: C7H11N3O
2-Amino-3,5,6-trimethyl-3,4-dihydropyrimidin-4-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 141 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/5/2019 1:43:31 PM |
| InChI | InChI=1S/C7H11N3O/c1-4-5(2)9-7(8)10(3)6(4)11/h1-3H3,(H2,8,9) |
| InChI Key | LFEKYWCIYUZCHO-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(N=C(N(C1=O)C)N)C |
| CAS | |
| Splash | |
| Other Names | 4(3H)-Pyrimidinone, 2-amino-3,5,6-trimethyl- |