Systematic / IUPAC Name: 3-(4-Cyanophenyl)prop-2-ynyl N-(3,5-dichlorophenyl)carbamate
ID: Reference8605
Other Names:
Formula: C17H10Cl2N2O2
3-(4-Cyanophenyl)prop-2-ynyl N-(3,5-dichlorophenyl)carbamate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 110 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/5/2019 1:48:13 PM |
| InChI | InChI=1S/C17H10Cl2N2O2/c18-14-8-15(19)10-16(9-14)21-17(22)23-7-1-2-12-3-5-13(11-20)6-4-12/h3-6,8-10H,7H2,(H,21,22) |
| InChI Key | RBSVXIQRGNWDLQ-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=CC=C1C#CCOC(=O)NC2=CC(=CC(=C2)Cl)Cl)C#N |
| CAS | |
| Splash | |
| Other Names |