Systematic / IUPAC Name: 2,4-Dichloro-N-[(Z)-[5-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]thiophen-2-yl]methylideneamino]benzamide
ID: Reference8618
Other Names:
Formula: C17H11Cl2F3N4OS
N'1-({5-[1-Methyl-5-(trifluoromethyl)-1H-pyrazol-3-yl]-2-thienyl}methylidene)-2,4-dichlorobenzene-1-carbohydrazide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 219 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/6/2019 7:11:58 AM |
| InChI | InChI=1S/C17H11Cl2F3N4OS/c1-26-15(17(20,21)22)7-13(25-26)14-5-3-10(28-14)8-23-24-16(27)11-4-2-9(18)6-12(11)19/h2-8H,1H3,(H,24,27)/b23-8- |
| InChI Key | RGWWYFZXGHEBFC-NYAPKIOYSA-N |
| Canonical SMILES | CN1C(=CC(=N1)C2=CC=C(S2)C=NNC(=O)C3=C(C=C(C=C3)Cl)Cl)C(F)(F)F |
| CAS | |
| Splash | |
| Other Names |
| PubChem | 5715779 |