Systematic / IUPAC Name: 2-Benzylsulfanylbenzoic acid
ID: Reference8633
Other Names:
2-(Benzylsulfanyl)benzenecarboxylic acid;
2-(Benzylthio)benzoic acid;
2-(Phenylmethylthio)benzoic acid;
Benzoic acid, 2-[(phenylmethyl)thio]-;
Benzylsulfanylbenzenecarboxylicacid
Formula: C14H12O2S
2-(Benzylsulfanyl)benzoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 108 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/6/2019 9:13:18 AM |
| InChI | InChI=1S/C14H12O2S/c15-14(16)12-8-4-5-9-13(12)17-10-11-6-2-1-3-7-11/h1-9H,10H2,(H,15,16) |
| InChI Key | IQMZULGMADGDLC-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)CSC2=CC=CC=C2C(=O)O |
| CAS | 1531802 |
| Splash | |
| Other Names |
2-(Benzylsulfanyl)benzenecarboxylic acid; 2-(Benzylthio)benzoic acid; 2-(Phenylmethylthio)benzoic acid; Benzoic acid, 2-[(phenylmethyl)thio]-; Benzylsulfanylbenzenecarboxylicacid |