Systematic / IUPAC Name: 5-[(4-Methylphenyl)methylsulfanyl]-4-phenyldithiole-3-thione
ID: Reference8638
Other Names: 3H-1,2-Dithiole-3-thione, 5-[[(4-methylphenyl)methyl]thio]-4-phenyl-
Formula: C17H14S4
5-[(4-Methylbenzyl)thio]-4-phenyl-3H-1,2-dithiole-3-thione mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 109 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/6/2019 9:28:22 AM |
| InChI | InChI=1S/C17H14S4/c1-12-7-9-13(10-8-12)11-19-17-15(16(18)20-21-17)14-5-3-2-4-6-14/h2-10H,11H2,1H3 |
| InChI Key | OUKCJDWWFQLSIW-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC=C(C=C1)CSC2=C(C(=S)SS2)C3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names | 3H-1,2-Dithiole-3-thione, 5-[[(4-methylphenyl)methyl]thio]-4-phenyl- |