Systematic / IUPAC Name: 4-(3-Methoxyphenyl)-3-(4-methoxyphenyl)-N-(pyridin-3-ylmethyl)-1,3-thiazol-2-imine
ID: Reference8639
Other Names: 3-Pyridinemethanamine, N-[(2Z)-4-(3-methoxyphenyl)-3-(4-methoxyphenyl)-2(3H)-thiazolylidene]-
Formula: C23H21N3O2S
N-[4-(3-Methoxyphenyl)-3-(4-methoxyphenyl)-1,3-thiazol-2(3H)-ylidene](3-pyridinyl)methanamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 110 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/6/2019 9:30:17 AM |
| InChI | InChI=1S/C23H21N3O2S/c1-27-20-10-8-19(9-11-20)26-22(18-6-3-7-21(13-18)28-2)16-29-23(26)25-15-17-5-4-12-24-14-17/h3-14,16H,15H2,1-2H3 |
| InChI Key | VSDBFSFTIQMYPV-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC=C(C=C1)N2C(=CSC2=NCC3=CN=CC=C3)C4=CC(=CC=C4)OC |
| CAS | |
| Splash | |
| Other Names | 3-Pyridinemethanamine, N-[(2Z)-4-(3-methoxyphenyl)-3-(4-methoxyphenyl)-2(3H)-thiazolylidene]- |