Systematic / IUPAC Name: 2-[[5-(Furan-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(5-thiophen-2-yl-1,3,4-thiadiazol-2-yl)acetamide
ID: Reference8641
Other Names: Acetamide, 2-[[5-(2-furanyl)-4-(2-propen-1-yl)-4H-1,2,4-triazol-3-yl]thio]-N-[5-(2-thienyl)-1,3,4-thiadiazol-2-yl]-
Formula: C17H14N6O2S3
2-{[4-Allyl-5-(2-furyl)-4H-1,2,4-triazol-3-yl]sulfanyl}-N-[5-(2-thienyl)-1,3,4-thiadiazol-2-yl]acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 220 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/6/2019 9:37:14 AM |
| InChI | InChI=1S/C17H14N6O2S3/c1-2-7-23-14(11-5-3-8-25-11)19-22-17(23)27-10-13(24)18-16-21-20-15(28-16)12-6-4-9-26-12/h2-6,8-9H,1,7,10H2,(H,18,21,24) |
| InChI Key | FHBXGXUFQLQUCI-UHFFFAOYSA-N |
| Canonical SMILES | C=CCN1C(=NN=C1SCC(=O)NC2=NN=C(S2)C3=CC=CS3)C4=CC=CO4 |
| CAS | |
| Splash | |
| Other Names | Acetamide, 2-[[5-(2-furanyl)-4-(2-propen-1-yl)-4H-1,2,4-triazol-3-yl]thio]-N-[5-(2-thienyl)-1,3,4-thiadiazol-2-yl]- |