Systematic / IUPAC Name: N-(2,3-Dihydro-1,4-benzodioxin-6-yl)-2-thiophen-2-yl-1,3-thiazole-4-carboxamide
ID: Reference8656
Other Names: 4-Thiazolecarboxamide, N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(2-thienyl)-
Formula: C16H12N2O3S2
N-(2,3-Dihydro-1,4-benzodioxin-6-yl)-2-(2-thienyl)-1,3-thiazole-4-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 110 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/6/2019 12:54:47 PM |
| InChI | InChI=1S/C16H12N2O3S2/c19-15(11-9-23-16(18-11)14-2-1-7-22-14)17-10-3-4-12-13(8-10)21-6-5-20-12/h1-4,7-9H,5-6H2,(H,17,19) |
| InChI Key | SBNJUYSMHHWRNF-UHFFFAOYSA-N |
| Canonical SMILES | C1COC2=C(O1)C=CC(=C2)NC(=O)C3=CSC(=N3)C4=CC=CS4 |
| CAS | |
| Splash | |
| Other Names | 4-Thiazolecarboxamide, N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(2-thienyl)- |