Systematic / IUPAC Name: 5-[2-(4-Methoxyphenoxy)-5-(trifluoromethyl)anilino]-5-oxo-3-phenylpentanoic acid
ID: Reference8658
Other Names: Benzenepropanoic acid, β-[2-[[2-(4-methoxyphenoxy)-5-(trifluoromethyl)phenyl]amino]-2-oxoethyl]-
Formula: C25H22F3NO5
5-[2-(4-Methoxyphenoxy)-5-(trifluoromethyl)anilino]-5-oxo-3-phenylpentanoicacid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 220 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/6/2019 12:58:31 PM |
| InChI | InChI=1S/C25H22F3NO5/c1-33-19-8-10-20(11-9-19)34-22-12-7-18(25(26,27)28)15-21(22)29-23(30)13-17(14-24(31)32)16-5-3-2-4-6-16/h2-12,15,17H,13-14H2,1H3,(H,29,30)(H,31,32) |
| InChI Key | UMUXAMJXLBOQNN-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC=C(C=C1)OC2=C(C=C(C=C2)C(F)(F)F)NC(=O)CC(CC(=O)O)C3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names | Benzenepropanoic acid, β-[2-[[2-(4-methoxyphenoxy)-5-(trifluoromethyl)phenyl]amino]-2-oxoethyl]- |
| PubChem | 2812813 |
| ChEMBL | CHEMBL1866344 |
| ChemSpider | 2091217 |