Systematic / IUPAC Name: N-(1,3-Benzodioxol-5-ylmethyl)-2-[(2-furylmethyl)sulfanyl]acetamide
ID: Reference8660
Other Names: Acetamide, N-(1,3-benzodioxol-5-ylmethyl)-2-[(2-furanylmethyl)thio]-
Formula: C15H15NO4S
N-(1,3-Benzodioxol-5-ylmethyl)-2-[(2-furylmethyl)sulfanyl]acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 110 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/6/2019 1:01:17 PM |
| InChI | InChI=1S/C15H15NO4S/c17-15(9-21-8-12-2-1-5-18-12)16-7-11-3-4-13-14(6-11)20-10-19-13/h1-6H,7-10H2,(H,16,17) |
| InChI Key | KPNWEKUIQHZILV-UHFFFAOYSA-N |
| Canonical SMILES | C1OC2=C(O1)C=C(C=C2)CNC(=O)CSCC3=CC=CO3 |
| CAS | |
| Splash | |
| Other Names | Acetamide, N-(1,3-benzodioxol-5-ylmethyl)-2-[(2-furanylmethyl)thio]- |