Systematic / IUPAC Name: 2,5-Dimethyl-N-(3-methyl-1,2-oxazol-5-yl)furan-3-carboxamide
ID: Reference8663
Other Names: 3-Furancarboxamide, 2,5-dimethyl-N-(3-methyl-5-isoxazolyl)-
Formula: C11H12N2O3
2,5-Dimethyl-N-(3-methyl-5-isoxazolyl)-3-furamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 138 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/6/2019 1:07:29 PM |
| InChI | InChI=1S/C11H12N2O3/c1-6-4-10(16-13-6)12-11(14)9-5-7(2)15-8(9)3/h4-5H,1-3H3,(H,12,14) |
| InChI Key | HMRGFGODYOZJFI-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC(=C(O1)C)C(=O)NC2=CC(=NO2)C |
| CAS | |
| Splash | |
| Other Names | 3-Furancarboxamide, 2,5-dimethyl-N-(3-methyl-5-isoxazolyl)- |