Systematic / IUPAC Name: 4-Chloro-N-[2-chloro-4-(trifluoromethyl)phenyl]benzenesulfonamide
ID: Reference8675
Other Names: Benzenesulfonamide, 4-chloro-N-[2-chloro-4-(trifluoromethyl)phenyl]-
Formula: C13H8Cl2F3NO2S
4-Chloro-N-[2-chloro-4-(trifluoromethyl)phenyl]benzenesulfonamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 60 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/6/2019 1:38:31 PM |
| InChI | InChI=1S/C13H8Cl2F3NO2S/c14-9-2-4-10(5-3-9)22(20,21)19-12-6-1-8(7-11(12)15)13(16,17)18/h1-7,19H |
| InChI Key | QQHGBOTVPDXYJQ-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=CC=C1S(=O)(=O)NC2=C(C=C(C=C2)C(F)(F)F)Cl)Cl |
| CAS | |
| Splash | |
| Other Names | Benzenesulfonamide, 4-chloro-N-[2-chloro-4-(trifluoromethyl)phenyl]- |
| ChemSpider | 2089266 |
| ChEMBL | CHEMBL2289609 |
| PubChem | 2810851 |