Systematic / IUPAC Name: 1-Pyrrolidin-1-yl-3-[3-(trifluoromethyl)pyrazol-1-yl]propan-2-ol
ID: Reference8679
Other Names: 1H-Pyrazole-1-ethanol, α-(1-pyrrolidinylmethyl)-3-(trifluoromethyl)-
Formula: C11H16F3N3O
1-Tetrahydro-1H-pyrrol-1-yl-3-[3-(trifluoromethyl)-1H-pyrazol-1-yl]propan-2-ol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 110 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/6/2019 2:33:31 PM |
| InChI | InChI=1S/C11H16F3N3O/c12-11(13,14)10-3-6-17(15-10)8-9(18)7-16-4-1-2-5-16/h3,6,9,18H,1-2,4-5,7-8H2 |
| InChI Key | BITXQCCVUCXHRC-UHFFFAOYSA-N |
| Canonical SMILES | C1CCN(C1)CC(CN2C=CC(=N2)C(F)(F)F)O |
| CAS | |
| Splash | |
| Other Names | 1H-Pyrazole-1-ethanol, α-(1-pyrrolidinylmethyl)-3-(trifluoromethyl)- |