Systematic / IUPAC Name: (E)-2-Methyl-4-[(4-methylthiophen-3-yl)amino]-4-oxobut-2-enoic acid
ID: Reference8682
Other Names:
2-Butenoic acid, 2-methyl-4-[(4-methyl-3-thienyl)amino]-4-oxo-, (2E)-;
(E)-4-Keto-2-methyl-4-[(4-methyl-3-thienyl)amino]but-2-enoic acid
Formula: C10H11NO3S
2-Methyl-4-[(4-methyl-3-thienyl)amino]-4-oxobut-2-enoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 110 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/8/2019 8:30:53 AM |
| InChI | InChI=1S/C10H11NO3S/c1-6(10(13)14)3-9(12)11-8-5-15-4-7(8)2/h3-5H,1-2H3,(H,11,12)(H,13,14)/b6-3+ |
| InChI Key | TZVWKLHESIYNQZ-ZZXKWVIFSA-N |
| Canonical SMILES | CC1=CSC=C1NC(=O)C=C(C)C(=O)O |
| CAS | |
| Splash | |
| Other Names |
2-Butenoic acid, 2-methyl-4-[(4-methyl-3-thienyl)amino]-4-oxo-, (2E)-; (E)-4-Keto-2-methyl-4-[(4-methyl-3-thienyl)amino]but-2-enoic acid |
| PubChem | 5714421 |
| ChemSpider | 4651877 |
| ChEMBL | CHEMBL1594870 |