Systematic / IUPAC Name: 3-[(Trifluoroacetyl)amino]-2-thiophenecarboxamide
ID: Reference8684
Other Names: 2-Thiophenecarboxamide, 3-[(2,2,2-trifluoroacetyl)amino]-
Formula: C7H5F3N2O2S
3-[(2,2,2-Trifluoroacetyl)amino]thiophene-2-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 110 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/8/2019 8:45:28 AM |
| InChI | InChI=1S/C7H5F3N2O2S/c8-7(9,10)6(14)12-3-1-2-15-4(3)5(11)13/h1-2H,(H2,11,13)(H,12,14) |
| InChI Key | MJKPFVGRSJOARU-UHFFFAOYSA-N |
| Canonical SMILES | C1=CSC(=C1NC(=O)C(F)(F)F)C(=O)N |
| CAS | |
| Splash | |
| Other Names | 2-Thiophenecarboxamide, 3-[(2,2,2-trifluoroacetyl)amino]- |