Systematic / IUPAC Name: N'-(3-Cyano-4-methylthiophen-2-yl)-N,N-dimethylmethanimidamide
ID: Reference8686
Other Names:
Methanimidamide, N'-(3-cyano-4-methyl-2-thienyl)-N,N-dimethyl-;
N'-(3-Cyano-4-methyl-2-thienyl)-N,N-dimethyliminoformamide
Formula: C9H11N3S
N'-(3-Cyano-4-methyl-2-thienyl)-N,N-dimethyliminoformamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 110 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/8/2019 8:51:37 AM |
| InChI | InChI=1S/C9H11N3S/c1-7-5-13-9(8(7)4-10)11-6-12(2)3/h5-6H,1-3H3/b11-6+ |
| InChI Key | YVQJIPAQSHUQIQ-IZZDOVSWSA-N |
| Canonical SMILES | CC1=CSC(=C1C#N)N=CN(C)C |
| CAS | |
| Splash | |
| Other Names |
Methanimidamide, N'-(3-cyano-4-methyl-2-thienyl)-N,N-dimethyl-; N'-(3-Cyano-4-methyl-2-thienyl)-N,N-dimethyliminoformamide |
| PubChem | 9583633 |
| ChEMBL | CHEMBL3198605 |
| ChemSpider | 7857780 |