Systematic / IUPAC Name: Pyrazolo[5,1-c][1,2,4]benzotriazin-8-yl dimethylcarbamate
ID: Reference8688
Other Names: Carbamic acid, N,N-dimethyl-, pyrazolo[5,1-c][1,2,4]benzotriazin-8-yl ester
Formula: C12H11N5O2
Benzo[E]pyrazolo[5,1-c][1,2,4]triazin-8-yl N,N-dimethylcarbamate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 110 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/8/2019 8:54:08 AM |
| InChI | InChI=1S/C12H11N5O2/c1-16(2)12(18)19-8-3-4-9-10(7-8)17-11(15-14-9)5-6-13-17/h3-7H,1-2H3 |
| InChI Key | CBEHDZXCPSGRMU-UHFFFAOYSA-N |
| Canonical SMILES | CN(C)C(=O)OC1=CC2=C(C=C1)N=NC3=CC=NN32 |
| CAS | |
| Splash | |
| Other Names | Carbamic acid, N,N-dimethyl-, pyrazolo[5,1-c][1,2,4]benzotriazin-8-yl ester |
| ChemSpider | 2085884 |
| PubChem | 2807425 |
| ChEMBL | CHEMBL569146 |