Systematic / IUPAC Name: N-[2-(4-Chloro-2-nitrophenyl)sulfanylphenyl]-4-methylbenzamide
ID: Reference8689
Other Names: Benzamide, N-[2-[(4-chloro-2-nitrophenyl)thio]phenyl]-4-methyl-
Formula: C20H15ClN2O3S
N1-{2-[(4-Chloro-2-nitrophenyl)sulfanyl]phenyl}-4-methylbenzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 220 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/8/2019 9:02:29 AM |
| InChI | InChI=1S/C20H15ClN2O3S/c1-13-6-8-14(9-7-13)20(24)22-16-4-2-3-5-18(16)27-19-11-10-15(21)12-17(19)23(25)26/h2-12H,1H3,(H,22,24) |
| InChI Key | DXVQPVBZLUJBHM-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | Benzamide, N-[2-[(4-chloro-2-nitrophenyl)thio]phenyl]-4-methyl- |