Systematic / IUPAC Name: N,N'-(2-Fluoro-1,3-phenylene)di(4-morpholinecarboxamide)
ID: Reference8701
Other Names: 4-Morpholinecarboxamide, N,N'-(2-fluoro-1,3-phenylene)bis-
Formula: C16H21FN4O4
N4-{2-Fluoro-3-[(morpholinocarbonyl)amino]phenyl}morpholine-4-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 205 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/8/2019 9:53:35 AM |
| InChI | InChI=1S/C16H21FN4O4/c17-14-12(18-15(22)20-4-8-24-9-5-20)2-1-3-13(14)19-16(23)21-6-10-25-11-7-21/h1-3H,4-11H2,(H,18,22)(H,19,23) |
| InChI Key | UDFWCENHQUWSPE-UHFFFAOYSA-N |
| Canonical SMILES | C1COCCN1C(=O)NC2=C(C(=CC=C2)NC(=O)N3CCOCC3)F |
| CAS | |
| Splash | |
| Other Names | 4-Morpholinecarboxamide, N,N'-(2-fluoro-1,3-phenylene)bis- |