Systematic / IUPAC Name: Ethyl 2-(2-cyanophenoxy)acetate
ID: Reference8714
            Other Names: 
                    (2-Cyano-phenoxy)-acetic acid ethyl ester; 
                    2-(2-Cyanophenoxy)acetic acid ethyl ester; 
                    Acetic acid, (2-cyanophenoxy)-, ethyl ester; 
                    Ethyl (2-cyanophenoxy)acetate
        
Formula: C11H11NO3
Ethyl 2-(2-cyanophenoxy)acetate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap | 
| No. of Spectral Trees | 1 | 
| No. of Spectra | 82 | 
| Tandem Spectra | MS1, MS2 | 
| Ionization Methods | ESI | 
| Analyzers | FT | 
| Last Modification | 3/8/2019 11:48:12 AM | 
| InChI | InChI=1S/C11H11NO3/c1-2-14-11(13)8-15-10-6-4-3-5-9(10)7-12/h3-6H,2,8H2,1H3 | 
| InChI Key | ORNAPWRLYAJFON-UHFFFAOYSA-N | 
| Canonical SMILES | CCOC(=O)COC1=CC=CC=C1C#N | 
| CAS | 39786340 | 
| Splash | |
| Other Names | 
                        (2-Cyano-phenoxy)-acetic acid ethyl ester;  2-(2-Cyanophenoxy)acetic acid ethyl ester; Acetic acid, (2-cyanophenoxy)-, ethyl ester; Ethyl (2-cyanophenoxy)acetate  |