Systematic / IUPAC Name: 2-[(3-Acetamido-3-oxopropyl)sulfanyl]-N-acetylbenzamide
ID: Reference8717
Other Names: Benzamide, N-acetyl-2-[[3-(acetylamino)-3-oxopropyl]thio]-
Formula: C14H16N2O4S
N1-Acetyl-2-{[3-(acetylamino)-3-oxopropyl]thio}benzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 110 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/8/2019 11:52:01 AM |
| InChI | InChI=1S/C14H16N2O4S/c1-9(17)15-13(19)7-8-21-12-6-4-3-5-11(12)14(20)16-10(2)18/h3-6H,7-8H2,1-2H3,(H,15,17,19)(H,16,18,20) |
| InChI Key | DJALIOOHHCVQKU-UHFFFAOYSA-N |
| Canonical SMILES | CC(=O)NC(=O)CCSC1=CC=CC=C1C(=O)NC(=O)C |
| CAS | |
| Splash | |
| Other Names | Benzamide, N-acetyl-2-[[3-(acetylamino)-3-oxopropyl]thio]- |