Systematic / IUPAC Name: 2-Carbamoylbenzoic acid
ID: Reference872
Other Names:
Benzoic acid, 2-(aminocarbonyl)-;
2-(Aminocarbonyl)benzoic acid;
Phthalamic acid;
Phthalamidic acid;
o-Carbamoylbenzoic acid
Formula: C8H7NO3
Phthalamic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 56 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/20/2015 9:20:42 AM |
| InChI | InChI=1S/C8H7NO3/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4H,(H2,9,10)(H,11,12) |
| InChI Key | CYMRPDYINXWJFU-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C(=C1)C(=O)N)C(=O)O |
| CAS | 88971 |
| Splash | |
| Other Names |
Benzoic acid, 2-(aminocarbonyl)-; 2-(Aminocarbonyl)benzoic acid; Phthalamic acid; Phthalamidic acid; o-Carbamoylbenzoic acid; Benzoic acid, o-carbamoyl- |
| ChemIDPlus | 000088971 |
| PubChem | 6957 |
| ChEBI | CHEBI:50736 |
| ChemSpider | 6691 |