Systematic / IUPAC Name: N-(4-Bromo-5-methyl-1,2-oxazol-3-yl)-5-nitrofuran-2-carboxamide
ID: Reference8730
Other Names:
2-Furancarboxamide, N-(4-bromo-5-methyl-3-isoxazolyl)-5-nitro-;
N-(4-Bromo-5-methyl-isoxazol-3-yl)-5-nitro-2-furamide
Formula: C9H6BrN3O5
N2-(4-Bromo-5-methylisoxazol-3-yl)-5-nitro-2-furamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 220 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/8/2019 12:32:46 PM |
| InChI | InChI=1S/C9H6BrN3O5/c1-4-7(10)8(12-18-4)11-9(14)5-2-3-6(17-5)13(15)16/h2-3H,1H3,(H,11,12,14) |
| InChI Key | ADOWXLLBBLZSCS-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C(=NO1)NC(=O)C2=CC=C(O2)[N+](=O)[O-])Br |
| CAS | |
| Splash | |
| Other Names |
2-Furancarboxamide, N-(4-bromo-5-methyl-3-isoxazolyl)-5-nitro-; N-(4-Bromo-5-methyl-isoxazol-3-yl)-5-nitro-2-furamide |
| PubChem | 2799295 |
| ChemSpider | 2078033 |
| ChEMBL | CHEMBL1594702 |