Systematic / IUPAC Name: Bis(2-ethylhexyl) 3,4,5,6-tetrabromobenzene-1,2-dicarboxylate
ID: Reference8746
Other Names:
TBPH;
Pyronil 45;
1,2-Benzenedicarboxylic acid, 3,4,5,6-tetrabromo-, 1,2-bis(2-ethylhexyl) ester;
1,2-Benzenedicarboxylic acid, 3,4,5,6-tetrabromo-, bis(2-ethylhexyl) ester;
Bis(2-ethylhexyl)tetrabromophthalate
; more
Formula: C24H34Br4O4
Class: Extractables/Leachables Textile Chemicals/Auxiliary/Dyes Industrial Chemicals
Bis(2-ethylhexyl)-3,4,5,6-tetrabromophthalate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion with FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 160 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/27/2019 12:01:08 PM |
| InChI | InChI=1S/C24H34Br4O4/c1-5-9-11-15(7-3)13-31-23(29)17-18(20(26)22(28)21(27)19(17)25)24(30)32-14-16(8-4)12-10-6-2/h15-16H,5-14H2,1-4H3 |
| InChI Key | UUEDINPOVKWVAZ-UHFFFAOYSA-N |
| Canonical SMILES | CCCCC(CC)COC(=O)C1=C(C(=C(C(=C1Br)Br)Br)Br)C(=O)OCC(CC)CCCC |
| CAS | 26040517 |
| Splash | |
| Other Names |
TBPH; Pyronil 45; 1,2-Benzenedicarboxylic acid, 3,4,5,6-tetrabromo-, 1,2-bis(2-ethylhexyl) ester; 1,2-Benzenedicarboxylic acid, 3,4,5,6-tetrabromo-, bis(2-ethylhexyl) ester; Bis(2-ethylhexyl)tetrabromophthalate; Di-2-Ethylhexyl tetrabromo phthalate; Phthalic acid, tetrabromo-, bis(2-ethylhexyl) ester |
| ChEMBL | CHEMBL3188536 |
| ChemSpider | 104816 |
| ChemIDPlus | 26040517 |
| PubChem | 117291 |