Systematic / IUPAC Name: Tris(2,3-dibromopropyl) phosphate
ID: Reference8748
Other Names:
TDBPP;
3PBR;
1-Propanol, 2,3-dibromo-, 1,1',1''-phosphate;
1-Propanol, 2,3-dibromo-, phosphate;
2,3-Dibromo-1-propanol phosphate
; more
Formula: C9H15Br6O4P
Class: Extractables/Leachables Textile Chemicals/Auxiliary/Dyes Industrial Chemicals
Tris(2,3-dibromopropyl) phosphate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion with FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 864 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/28/2019 10:01:03 AM |
| InChI | InChI=1S/C9H15Br6O4P/c10-1-7(13)4-17-20(16,18-5-8(14)2-11)19-6-9(15)3-12/h7-9H,1-6H2 |
| InChI Key | PQYJRMFWJJONBO-UHFFFAOYSA-N |
| Canonical SMILES | C(C(CBr)Br)OP(=O)(OCC(CBr)Br)OCC(CBr)Br |
| CAS | 126727 |
| Splash | |
| Other Names |
TDBPP; 3PBR; 1-Propanol, 2,3-dibromo-, 1,1',1''-phosphate; 1-Propanol, 2,3-dibromo-, phosphate; 2,3-Dibromo-1-propanol phosphate; Anfram 3PB; Apex 462-5; Bromkal P 67-6HP; Firemaster LV-T 23P; Firemaster T 23; Firemaster T23P; Firemaster T23p-lv; Flacavon R; Flamex T 23P; Flammex AP; Flammex LV-T 23P; Flammex T 23P; Fyrol HB32; Phoscon PE 60; Phoscon UF-S; T 23P; Tdbp; Tris-BP; Zetifex zn; Zetofex ZN; 2,3-Dibromopropyl phosphate; Phosphoric acid tri-(2,3-dibromopropyl) ester; Phosphoric acid, tris(2,3-dibromopropyl) ester; Tris(2,3-dibromo-1-propyl)phosphate; Tris(2,3-dibromopropyl) phosphoric acid ester; Tris-(2,3-dibrompropyl)fosfat; Tris(dibromopropyl)phosphate; Tris-2,3-dibrompropyl ester kyseliny fosforecne; TRIS |
| KEGG | C19182 |
| ChemIDPlus | 000126727 |
| ChEMBL | CHEMBL1904600 |
| ChemSpider | 29089 |
| Wikipedia | Tris(2,3-dibromopropyl)_phosphate |
| PubChem | 31356 |
| ChEBI | CHEBI:82282 |
| WebBook | 3550626795 |