Systematic / IUPAC Name: 2-[(4-tert-Butylphenoxy)methyl]oxirane
ID: Reference8755
Other Names:
p-tert-Butylphenyl glycidyl ether;
Araldite m;
Heloxy 65;
[[4-(1,1-Dimethylethyl)phenoxy]methyl]oxirane;
1-(p-tert-Butylphenoxy)-2,3-epoxypropane
; more
Formula: C13H18O2
Class: Extractables/Leachables Textile Chemicals/Auxiliary/Dyes
4-tert-Butylphenyl glycidyl ether mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion with FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 164 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/29/2019 6:32:38 AM |
| InChI | InChI=1S/C13H18O2/c1-13(2,3)10-4-6-11(7-5-10)14-8-12-9-15-12/h4-7,12H,8-9H2,1-3H3 |
| InChI Key | HHRACYLRBOUBKM-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)(C)C1=CC=C(C=C1)OCC2CO2 |
| CAS | 3101608 |
| Splash | |
| Other Names |
p-tert-Butylphenyl glycidyl ether; Araldite m; Heloxy 65; [[4-(1,1-Dimethylethyl)phenoxy]methyl]oxirane; 1-(p-tert-Butylphenoxy)-2,3-epoxypropane; 3-(p-tert-Butylphenoxy)-1,2-epoxypropane; 4-t-Butylphenyl glycidyl ether; 4-tert-Butylphenyl 2,3-epoxypropyl ether; Butylphenyl glycidyl ether, p-tert-; Oxirane, [[4-(1,1-dimethylethyl)phenoxy]methyl]-; Oxirane, 2-[[4-(1,1-dimethylethyl)phenoxy]methyl]-; Propane, 1-(p-tert-butylphenoxy)-2,3-epoxy-; p-tert-Butylphenyl 1-(2,3-epoxy)propyl ether; t-Butyl phenyl glycidyl ether; tert-Butylphenol glycidyl ether; tert-Butylphenyl glycidyl ether |
| ChemSpider | 17339 |
| ChEMBL | CHEMBL1890780 |
| PubChem | 18360 |
| ChemIDPlus | 765305188 |
| WebBook | 4230310929 |