Systematic / IUPAC Name: N-Phenylnaphthalen-2-amine
ID: Reference8762
Other Names:
PBNA;
2-Anilinonaphthalene;
Aceto pbn;
Agerite powder;
Anilinonaphthalene
; more
Formula: C16H13N
Class: Endogenous Metabolites Extractables/Leachables Textile Chemicals/Auxiliary/Dyes
N-Phenyl-2-naphthylamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion with FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 660 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/1/2019 11:52:59 AM |
| InChI | InChI=1S/C16H13N/c1-2-8-15(9-3-1)17-16-11-10-13-6-4-5-7-14(13)12-16/h1-12,17H |
| InChI Key | KEQFTVQCIQJIQW-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)NC2=CC3=CC=CC=C3C=C2 |
| CAS | 135886 |
| Splash | |
| Other Names |
PBNA; 2-Anilinonaphthalene; Aceto pbn; Agerite powder; Anilinonaphthalene; Antioxidant 116; Antioxidant pbn; Antioxygene MC; Fenyl-β-naftylamin; N-2-Naphthylaniline; Naftam 2; Neosone D; Neozon D; Neozone; Neozone D; Nilox pbna; Noclizer D; Nocrac D; Nonox D; Nonox DN; Stabilator AR; Stabilizator AR; Stabilizer AR; Vulkanox pbn; 2-(N-Phenylamino)naphthalene; 2-Naphthalenamine, N-phenyl-; 2-Naphthylamine, N-phenyl-; 2-Naphthylphenylamine; 2-Phenylaminonaphthalene; β-Naphthylphenylamine; N-(2-Naphthyl)-N-phenylamine; N-β-Naphthyl-N-phenylamine; N-Fenyl-2-aminonaftalen; N-Phenyl-β-amino-naphthalene; N-Phenyl-2-naphthalenamine; N-Phenyl-β-naphthylamine; Phenyl-2-naphthylamine; Phenyl-β-naphthylamine; Phenyl-β-naphtilamine |
| KEGG | C14694 |
| PubChem | 8679 |
| ChemSpider | 8355 |
| ChemIDPlus | 000135886 |
| ChEMBL | CHEMBL1543632 |
| HMDb | HMDB32865 |
| ChEBI | CHEBI:34877 |
| WebBook | 2598118334 |