Systematic / IUPAC Name: 2-O-Decyl 1-O-octyl benzene-1,2-dicarboxylate
ID: Reference8766
Other Names:
Dinopol 235;
Polycizer 532;
Polycizer 562;
Staflex 500;
1,2-Benzenedicarboxylic acid decyl octyl ester
; more
Formula: C26H42O4
Class: Extractables/Leachables Textile Chemicals/Auxiliary/Dyes Industrial Chemicals
Octyl decyl phthalate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion with FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 374 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/2/2019 7:40:40 AM |
| InChI | InChI=1S/C26H42O4/c1-3-5-7-9-11-12-14-18-22-30-26(28)24-20-16-15-19-23(24)25(27)29-21-17-13-10-8-6-4-2/h15-16,19-20H,3-14,17-18,21-22H2,1-2H3 |
| InChI Key | LVAGMBHLXLZJKZ-UHFFFAOYSA-N |
| Canonical SMILES | CCCCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCC |
| CAS | 119073 |
| Splash | |
| Other Names |
Dinopol 235; Polycizer 532; Polycizer 562; Staflex 500; 1,2-Benzenedicarboxylic acid decyl octyl ester; 1,2-Benzenedicarboxylic acid, decyl octyl ester; 1,2-Benzenedicarboxylicacid, 1-decyl 2-octyl ester; Decyl octyl 1,2-benzenedicarboxylate; Decyl octyl phthalate; n-Decyl n-octyl phthalate; n-Octyl-n-decyl phthalate; Phthalic acid, decyl octyl ester; Phthalic acid, octyldecyl ester |
| ChEMBL | CHEMBL3183781 |
| ChemSpider | 8077 |
| WebBook | 2211701877 |
| PubChem | 8380 |
| ChemIDPlus | 000119073 |