Systematic / IUPAC Name: 2-(Diethylamino)ethyl 2,2-diphenylpentanoate
ID: Reference877
Other Names:
Ethyl aprofen;
Acetic acid, propyldiphenyl-, 2-(diethylamino)ethyl ester;
Benzeneacetic acid, α-phenyl-α-propyl-, 2-(diethylamino)ethyl ester;
2,2-Diphenylpentansaeure-2-diethylaminoethylester;
Valeric acid, 2,2-diphenyl-, 2-(diethylamino)ethyl ester
Formula: C23H31NO2
Class: Therapeutics/Prescription Drugs
Proadifen mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 123 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/20/2015 1:48:11 PM |
| InChI | InChI=1S/C23H31NO2/c1-4-17-23(20-13-9-7-10-14-20,21-15-11-8-12-16-21)22(25)26-19-18-24(5-2)6-3/h7-16H,4-6,17-19H2,1-3H3 |
| InChI Key | SNTQPLDRUZOSDP-UHFFFAOYSA-N |
| Canonical SMILES | CCCC(C1=CC=CC=C1)(C2=CC=CC=C2)C(=O)OCCN(CC)CC |
| CAS | 302330 |
| Splash | |
| Other Names |
Ethyl aprofen; Acetic acid, propyldiphenyl-, 2-(diethylamino)ethyl ester; Benzeneacetic acid, α-phenyl-α-propyl-, 2-(diethylamino)ethyl ester; 2,2-Diphenylpentansaeure-2-diethylaminoethylester; Valeric acid, 2,2-diphenyl-, 2-(diethylamino)ethyl ester |
| PubChem | 4910 |
| ChemIDPlus | 000302330 |
| ChemSpider | 4741 |
| ChEMBL | CHEMBL282567 |
| Wikipedia | Proadifen |