Systematic / IUPAC Name: Diundecyl benzene-1,2-dicarboxylate
ID: Reference8777
Other Names:
Di-711-Phthalate;
Jayflex dup;
Jayflex L 11P;
Santicizer 711;
1,2-Benzenedicarboxylic acid, 1,2-diundecyl ester
; more
Formula: C30H50O4
Class: Extractables/Leachables Personal Care Products/Cosmetics Textile Chemicals/Auxiliary/Dyes Industrial Chemicals
Diundecyl phthalate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion with FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 695 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/3/2019 1:42:17 PM |
| InChI | InChI=1S/C30H50O4/c1-3-5-7-9-11-13-15-17-21-25-33-29(31)27-23-19-20-24-28(27)30(32)34-26-22-18-16-14-12-10-8-6-4-2/h19-20,23-24H,3-18,21-22,25-26H2,1-2H3 |
| InChI Key | QQVHEQUEHCEAKS-UHFFFAOYSA-N |
| Canonical SMILES | CCCCCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCCCCC |
| CAS | 3648202 |
| Splash | |
| Other Names |
Di-711-Phthalate; Jayflex dup; Jayflex L 11P; Santicizer 711; 1,2-Benzenedicarboxylic acid, 1,2-diundecyl ester; 1,2-Benzenedicarboxylic acid, diundecyl ester; Di-n-Undecyl phthalate; Phthalic acid diundecyl ester; Phthalic acid, bis-n-undecyl ester; Phthalic acid, diundecyl ester; Phthalic acid, diundecyl ester, branched and linear; Undecyl 2-(undecyloxycarbonyl)benzoate; DuDP |
| WebBook | 263260761 |
| ChemIDPlus | 003648202 |
| ChEMBL | CHEMBL1495577 |
| ChemSpider | 18193 |
| PubChem | 19283 |
| Wikipedia | Diundecylphthalat (DE) |