Systematic / IUPAC Name: 4-Amino-N-[2-(diethylamino)ethyl]benzamide
ID: Reference878
Other Names:
Novocainamide;
Procamide;
Procaine amide;
Novocaine amide;
p-Amino-N-(2-diethylaminoethyl)benzamide
; more
Formula: C13H21N3O
Class: Therapeutics/Prescription Drugs
Procainamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 143 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/20/2015 2:08:10 PM |
| InChI | InChI=1S/C13H21N3O/c1-3-16(4-2)10-9-15-13(17)11-5-7-12(14)8-6-11/h5-8H,3-4,9-10,14H2,1-2H3,(H,15,17) |
| InChI Key | REQCZEXYDRLIBE-UHFFFAOYSA-N |
| Canonical SMILES | CCN(CC)CCNC(=O)C1=CC=C(C=C1)N |
| CAS | 51069 |
| Splash | |
| Other Names |
Novocainamide; Procamide; Procaine amide; Novocaine amide; p-Amino-N-(2-diethylaminoethyl)benzamide; Benzamide, p-amino-N-[2-(diethylamino)ethyl]-; Benzamide, p-amino-N-(2-(diethylamino)ethyl)-; (4-Aminophenyl)-N-[2-(diethylamino)ethyl]carboxamide; N1-[2-(Diethylamino)ethyl]-4-aminobenzamide; Biocoryl; Pronestyl; Novocamid; Novocainamid; Procan; Procanbid |
| ChEMBL | CHEMBL640 |
| PubChem | 4913 |
| ChEBI | CHEBI:8428 |
| Wikipedia | Procainamide |
| ChemIDPlus | 000051069 |
| ChemSpider | 4744 |
| HMDb | HMDB15169 |
| DrugBank | APRD00509 |
| KEGG | C07401; D08421 |