Systematic / IUPAC Name: [Cyano-(3-phenoxyphenyl)methyl] 2-(4-chlorophenyl)-3-methylbutanoate
ID: Reference8780
Other Names:
Agrofen;
Aqmatrine;
Asana;
Asana XL;
Belmark
; more
Formula: C25H22ClNO3
Class: Pesticides/Herbicides
Fenvalerate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion with FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1850 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/4/2019 8:40:59 AM |
| InChI | InChI=1S/C25H22ClNO3/c1-17(2)24(18-11-13-20(26)14-12-18)25(28)30-23(16-27)19-7-6-10-22(15-19)29-21-8-4-3-5-9-21/h3-15,17,23-24H,1-2H3 |
| InChI Key | NYPJDWWKZLNGGM-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)C(C1=CC=C(C=C1)Cl)C(=O)OC(C#N)C2=CC(=CC=C2)OC3=CC=CC=C3 |
| CAS | 51630581 |
| Splash | |
| Other Names |
Agrofen; Aqmatrine; Asana; Asana XL; Belmark; Ectrin; Evercide 2362; Fenaxin; Fenkem; Fenkill; Fenoxin; Fenval; Fenvalarate; Furitrothion; Gold crest tribute; Halmark; Insectral; Phenoxin; Pydrin; Pydrin, (R-(R*,S*))-isomer; Sanmarton; Sumi-α; Sumibac; Sumicidin; Sumicidin 20E; Sumicidin A α; Sumifleece; Sumifly; Sumipower; Sumitick; Sumkidin; Tirade; Tribute; (Cyano(3-phenoxyphenyl)methyl-4-chloro-α-(1-methylethyl)phenylacetate); (RS)-α-Cyano-3-phenoxybenzyl (RS)-2-(4-chlorophenyl)-3-methylbutyrate; (S)-α-Cyano-3-phenoxybenzyl(S)-2-(4-chlorophenyl)-3-methylbutyrate; (S)-α-Cyano-3-phenoxybenzyl(S)-2-(4-chlorophenyl)isovalerate; 4-Chloro-α-(1-methylethyl)benzeneacetic acid cyano(3-phenoxyphenyl)methyl ester; a-Cyano-3-phenoxybenzyl 2-(4-chlorophenyl)-3-methylbutyrate; α-Cyano-(3-phenoxyphenyl)methyl-4-chloro-α-(1-methylethyl)benzeneacetate; α-Cyano-3-phenoxybenzyl 2-(4-chlorophenyl)-3-methylbutyrate; α-Cyano-3-phenoxybenzyl 2-(4-chlorophenyl)isovalerate; α-Cyano-3-phenoxybenzyl α-isopropyl-4-chlorophenylacetate; α-Cyano-3-phenoxybenzyl-α-(4-chlorophenyl)isovalerate; α-Cyano-m-phenoxybenzyl 2-(p-chlorophenyl)-3-methylbutyrate; Benzeneacetic acid, 4-chloro-α-(1-methylethyl)-, (S)-cyano(3-phenoxyphenyl)methyl ester, ( α S)-; Benzeneacetic acid, 4-chloro-α-(1-methylethyl)-, cyano (3-phenoxyphenyl)methyl ester,(S-(R*,R*))-; Benzeneacetic acid, 4-chloro-α-(1-methylethyl)-, cyano(3-phenoxyphenyl)methyl ester; Benzeneacetic acid, 4-chloro-α-(1-methylethyl)-, cyano(3-phenoxyphenyl)methyl ester, (R-(R*,R*))-; Benzeneacetic acid, 4-chloro-α-(1-methylethyl)-, cyano(3-phenoxyphenyl)methyl ester, (R-(R*,S*))-; Benzeneacetic acid, 4-chloro-α-(1-methylethyl)-, cyano(3-phenoxyphenyl)methyl ester, (S-(R*,S*))-; Cyano (3-phenoxybenzyl)-2-(4-chlorophenyl)-3-methylbutyrate; Cyano(3-phenoxyphenyl)methyl 4-chloro-α-(1-methylethyl)benzeneacetate; Cyano[3-(phenyloxy)phenyl]methyl 2-(4-chlorophenyl)-3-methylbutanoate; Fenvalerate α; Fenvalerate A α; Fenvalerate A-β; Fenvalerate β; Fenvalerate E C; Phenvalerate |
| PubChem | 3347 |
| ChemIDPlus | CY15763700 |
| ChEMBL | CHEMBL492491 |
| KEGG | D07952 |
| ChEBI | CHEBI:5014 |
| HMDb | HMDB31791 |
| Wikipedia | Fenvalerate |
| ChemSpider | 3230 |
| WebBook | 3232645153 |