Systematic / IUPAC Name: 9-Phenyl-3-(thiophene-2-carbonyl)-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione
ID: Reference8785
Other Names:
Pyrazino[2,1-c][1,4]benzodiazepine-6,12(2H,11H)-dione, 1,3,4,12a-tetrahydro-8-phenyl-2-(2-thienylcarbonyl)-;
NAT9-272977
Formula: C23H19N3O3S
8-Phenyl-2-(2-thienylcarbonyl)-1,3,4,12a-tetrahydropyrazino[2,1-c][1,4]benzodiazepine-6,12(2H,11H)-dione mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1160 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/22/2019 11:42:43 AM |
| InChI | InChI=1S/C23H19N3O3S/c27-21-19-14-25(23(29)20-7-4-12-30-20)10-11-26(19)22(28)17-13-16(8-9-18(17)24-21)15-5-2-1-3-6-15/h1-9,12-13,19H,10-11,14H2,(H,24,27) |
| InChI Key | RJSJLGLZEUJCDZ-UHFFFAOYSA-N |
| Canonical SMILES | C1CN2C(CN1C(=O)C3=CC=CS3)C(=O)NC4=C(C2=O)C=C(C=C4)C5=CC=CC=C5 |
| CAS | |
| Splash | |
| Other Names |
Pyrazino[2,1-c][1,4]benzodiazepine-6,12(2H,11H)-dione, 1,3,4,12a-tetrahydro-8-phenyl-2-(2-thienylcarbonyl)-; NAT9-272977 |