Systematic / IUPAC Name: 3-Hydroxy-4-(trimethylazaniumyl)butanoate
ID: Reference881
Other Names:
(1)-(3-Carboxy-2-hydroxypropyl)trimethylammonium hydroxide;
Carnitine
Formula: C7H16NO3 +
Class: Endogenous Metabolites
DL-Carnitine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 458 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 3/24/2015 9:02:08 AM |
| InChI | InChI=1S/C7H15NO3/c1-8(2,3)5-6(9)4-7(10)11/h6,9H,4-5H2,1-3H3 |
| InChI Key | PHIQHXFUZVPYII-UHFFFAOYSA-N |
| Canonical SMILES | C[N+](C)(C)CC(CC(=O)[O-])O |
| CAS | 406768 |
| Splash | |
| Other Names |
(1)-(3-Carboxy-2-hydroxypropyl)trimethylammonium hydroxide; Carnitine |
| ChEBI | CHEBI:17126 |
| Wikipedia | Carnitine |
| ChemSpider | 282 |
| ChEMBL | CHEMBL172513 |
| PubChem | 288 |